C15H17N3O4S — CID 28589064
N-[(Z)-furan-2-ylmethylideneamino]-2-(3-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 28589064) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is N-[(Z)-furan-2-ylmethylideneamino]-2-(3-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-furan-2-ylmethylideneamino]-2-(3-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 28589064 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[(Z)-furan-2-ylmethylideneamino]-2-(3-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1cccc(N(CC(=O)N/N=C\c2ccco2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H17N3O4S/c1-12-5-3-6-13(9-12)18(23(2,20)21)11-15(19)17-16-10-14-7-4-8-22-14/h3-10H,11H2,1-2H3,(H,17,19)/b16-10- |
| InChIKey | GANZWBFHHPFVGD-YBEGLDIGSA-N |
| XLogP | 1.50 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|