C4H7F2NO4S — CID 28606630
2-[difluoromethylsulfonyl(methyl)amino]acetic acid (PubChem CID 28606630) has the molecular formula C4H7F2NO4S and a molecular weight of 203.17 g/mol. Its IUPAC name is 2-[difluoromethylsulfonyl(methyl)amino]acetic acid.
| Compound Name | 2-[difluoromethylsulfonyl(methyl)amino]acetic acid |
|---|---|
| PubChem CID | 28606630 |
| Molecular Formula | C4H7F2NO4S |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | 2-[difluoromethylsulfonyl(methyl)amino]acetic acid |
| SMILES | CN(CC(=O)O)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C4H7F2NO4S/c1-7(2-3(8)9)12(10,11)4(5)6/h4H,2H2,1H3,(H,8,9) |
| InChIKey | QPTHHOAXJYZETQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |