C18H17Cl2NO3S — CID 28633008
ethyl 2-chloro-4-[[(2R)-2-(4-chlorophenyl)sulfanylpropanoyl]amino]benzoate (PubChem CID 28633008) has the molecular formula C18H17Cl2NO3S and a molecular weight of 398.31 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[(2R)-2-(4-chlorophenyl)sulfanylpropanoyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[(2R)-2-(4-chlorophenyl)sulfanylpropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 28633008 |
| Molecular Formula | C18H17Cl2NO3S |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | ethyl 2-chloro-4-[[(2R)-2-(4-chlorophenyl)sulfanylpropanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H](C)Sc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C18H17Cl2NO3S/c1-3-24-18(23)15-9-6-13(10-16(15)20)21-17(22)11(2)25-14-7-4-12(19)5-8-14/h4-11H,3H2,1-2H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | WBDDASRJZKOPGW-LLVKDONJSA-N |
| XLogP | 5.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |