C20H21BrN2O3 — CID 28642553
N-(3-amino-3-oxopropyl)-N-benzyl-3-bromo-4-prop-2-enoxybenzamide (PubChem CID 28642553) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-N-benzyl-3-bromo-4-prop-2-enoxybenzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-N-benzyl-3-bromo-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 28642553 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-N-benzyl-3-bromo-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N(CCC(N)=O)Cc2ccccc2)cc1Br |
| InChI | InChI=1S/C20H21BrN2O3/c1-2-12-26-18-9-8-16(13-17(18)21)20(25)23(11-10-19(22)24)14-15-6-4-3-5-7-15/h2-9,13H,1,10-12,14H2,(H2,22,24) |
| InChIKey | SPDCEGBFORCWTG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|