C23H25NO4 — CID 28672317
3-butoxy-N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]benzamide (PubChem CID 28672317) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-butoxy-N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]benzamide.
| Compound Name | 3-butoxy-N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]benzamide |
|---|---|
| PubChem CID | 28672317 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-butoxy-N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2ccc(-c3ccc(CO)o3)c(C)c2)c1 |
| InChI | InChI=1S/C23H25NO4/c1-3-4-12-27-19-7-5-6-17(14-19)23(26)24-18-8-10-21(16(2)13-18)22-11-9-20(15-25)28-22/h5-11,13-14,25H,3-4,12,15H2,1-2H3,(H,24,26) |
| InChIKey | XPFYLCXVBQOEKJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|