C20H15NO4 — CID 28689
View drug profile → bisoxatin2,2-bis(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one (PubChem CID 28689) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2,2-bis(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2,2-bis(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28689 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2,2-bis(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2ccccc2OC1(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H15NO4/c22-15-9-5-13(6-10-15)20(14-7-11-16(23)12-8-14)19(24)21-17-3-1-2-4-18(17)25-20/h1-12,22-23H,(H,21,24) |
| InChIKey | BPKUDUSVDVLOPY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |