About N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine
N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 28695635) has the molecular formula C20H16ClN3OS
and a molecular weight of 381.89 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 28695635 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(Nc3cc(Cl)ccc3Oc3ccccc3)ncnc2s1 |
| InChI | InChI=1S/C20H16ClN3OS/c1-2-15-11-16-19(22-12-23-20(16)26-15)24-17-10-13(21)8-9-18(17)25-14-6-4-3-5-7-14/h3-12H,2H2,1H3,(H,22,23,24) |
| InChIKey | OJIAJXXIJCIBSI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine (CID 28695635) is N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine is CCc1cc2c(Nc3cc(Cl)ccc3Oc3ccccc3)ncnc2s1.
What is the InChIKey of N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is OJIAJXXIJCIBSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3OS/c1-2-15-11-16-19(22-12-23-20(16)26-15)24-17-10-13(21)8-9-18(17)25-14-6-4-3-5-7-14/h3-12H,2H2,1H3,(H,22,23,24).
What are the key properties of N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine?
N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 381.89 g/mol, XLogP of 6.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-phenoxyphenyl)-6-ethylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 28695635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).