C17H15ClN2S — CID 28709994
5-(chloromethyl)-4-(2,5-dimethylphenyl)-2-pyridin-2-yl-1,3-thiazole (PubChem CID 28709994) has the molecular formula C17H15ClN2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 5-(chloromethyl)-4-(2,5-dimethylphenyl)-2-pyridin-2-yl-1,3-thiazole.
| Compound Name | 5-(chloromethyl)-4-(2,5-dimethylphenyl)-2-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 28709994 |
| Molecular Formula | C17H15ClN2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5-(chloromethyl)-4-(2,5-dimethylphenyl)-2-pyridin-2-yl-1,3-thiazole |
| SMILES | Cc1ccc(C)c(-c2nc(-c3ccccn3)sc2CCl)c1 |
| InChI | InChI=1S/C17H15ClN2S/c1-11-6-7-12(2)13(9-11)16-15(10-18)21-17(20-16)14-5-3-4-8-19-14/h3-9H,10H2,1-2H3 |
| InChIKey | RPNZXVLCJDAURM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|