About ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate
ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate (PubChem CID 2871820) has the molecular formula C19H21ClN2O4S
and a molecular weight of 408.91 g/mol. Its IUPAC name is ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate |
| PubChem CID | 2871820 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)C1(CC)CC(C)(c2csc(Nc3ccccc3Cl)n2)OC1=O |
| InChI | InChI=1S/C19H21ClN2O4S/c1-4-19(15(23)25-5-2)11-18(3,26-16(19)24)14-10-27-17(22-14)21-13-9-7-6-8-12(13)20/h6-10H,4-5,11H2,1-3H3,(H,21,22) |
| InChIKey | HKWSHDBAKRETSE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate?
The IUPAC name of ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate (CID 2871820) is ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate.
What is the SMILES notation for ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate?
The canonical SMILES for ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate is CCOC(=O)C1(CC)CC(C)(c2csc(Nc3ccccc3Cl)n2)OC1=O.
What is the InChIKey of ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate?
The InChIKey is HKWSHDBAKRETSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2O4S/c1-4-19(15(23)25-5-2)11-18(3,26-16(19)24)14-10-27-17(22-14)21-13-9-7-6-8-12(13)20/h6-10H,4-5,11H2,1-3H3,(H,21,22).
What are the key properties of ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate?
ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate has a molecular weight of 408.91 g/mol, XLogP of 4.66, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate is sourced from PubChem (CID 2871820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).