C20H22N2O4S — CID 40637448
(3R,5R)-3,8,8-trimethyl-3-[2-(2-methylanilino)-1,3-thiazol-4-yl]-2,7-dioxaspiro[4.4]nonane-1,6-dione (PubChem CID 40637448) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is (3R,5R)-3,8,8-trimethyl-3-[2-(2-methylanilino)-1,3-thiazol-4-yl]-2,7-dioxaspiro[4.4]nonane-1,6-dione.
| Compound Name | (3R,5R)-3,8,8-trimethyl-3-[2-(2-methylanilino)-1,3-thiazol-4-yl]-2,7-dioxaspiro[4.4]nonane-1,6-dione |
|---|---|
| PubChem CID | 40637448 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (3R,5R)-3,8,8-trimethyl-3-[2-(2-methylanilino)-1,3-thiazol-4-yl]-2,7-dioxaspiro[4.4]nonane-1,6-dione |
| SMILES | Cc1ccccc1Nc1nc([C@@]2(C)C[C@@]3(CC(C)(C)OC3=O)C(=O)O2)cs1 |
| InChI | InChI=1S/C20H22N2O4S/c1-12-7-5-6-8-13(12)21-17-22-14(9-27-17)19(4)11-20(16(24)26-19)10-18(2,3)25-15(20)23/h5-9H,10-11H2,1-4H3,(H,21,22)/t19-,20-/m1/s1 |
| InChIKey | KRXVKWJVTLVGSE-WOJBJXKFSA-N |
| XLogP | 4.07 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|