C10H9FN2OS — CID 2872834
2-amino-5-[(4-fluorophenyl)methyl]-1,3-thiazol-4-one (PubChem CID 2872834) has the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-amino-5-[(4-fluorophenyl)methyl]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(4-fluorophenyl)methyl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2872834 |
| Molecular Formula | C10H9FN2OS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-amino-5-[(4-fluorophenyl)methyl]-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)C(Cc2ccc(F)cc2)S1 |
| InChI | InChI=1S/C10H9FN2OS/c11-7-3-1-6(2-4-7)5-8-9(14)13-10(12)15-8/h1-4,8H,5H2,(H2,12,13,14) |
| InChIKey | UASXAYBRRLOPQA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |