C16H18N4S — CID 28750643
2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]ethanamine (PubChem CID 28750643) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is 2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]ethanamine.
| Compound Name | 2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 28750643 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]ethanamine |
| SMILES | NCCc1nn2cc(-c3ccc4c(c3)CCCC4)nc2s1 |
| InChI | InChI=1S/C16H18N4S/c17-8-7-15-19-20-10-14(18-16(20)21-15)13-6-5-11-3-1-2-4-12(11)9-13/h5-6,9-10H,1-4,7-8,17H2 |
| InChIKey | BYJADGSIZAHQHW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |