C14H14N4S — CID 95473970
6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 95473970) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 95473970 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | Nc1nn2cc(-c3ccc4c(c3)CCCC4)nc2s1 |
| InChI | InChI=1S/C14H14N4S/c15-13-17-18-8-12(16-14(18)19-13)11-6-5-9-3-1-2-4-10(9)7-11/h5-8H,1-4H2,(H2,15,17) |
| InChIKey | UQQFUGBRYQKOEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |