C10H14F2N2O2S — CID 28794316
2-amino-N-(2,4-difluorophenyl)-N-ethylethanesulfonamide (PubChem CID 28794316) has the molecular formula C10H14F2N2O2S and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-amino-N-(2,4-difluorophenyl)-N-ethylethanesulfonamide.
| Compound Name | 2-amino-N-(2,4-difluorophenyl)-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 28794316 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-amino-N-(2,4-difluorophenyl)-N-ethylethanesulfonamide |
| SMILES | CCN(c1ccc(F)cc1F)S(=O)(=O)CCN |
| InChI | InChI=1S/C10H14F2N2O2S/c1-2-14(17(15,16)6-5-13)10-4-3-8(11)7-9(10)12/h3-4,7H,2,5-6,13H2,1H3 |
| InChIKey | VCUSBGBURURWFR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |