C24H25N3O5S2 — CID 28822590
methyl 2-[[[(2R)-2-(3-methoxyphenoxy)propanoyl]amino]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 28822590) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is methyl 2-[[[(2R)-2-(3-methoxyphenoxy)propanoyl]amino]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[[(2R)-2-(3-methoxyphenoxy)propanoyl]amino]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 28822590 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | methyl 2-[[[(2R)-2-(3-methoxyphenoxy)propanoyl]amino]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NNC(=O)[C@@H](C)Oc2cccc(OC)c2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C24H25N3O5S2/c1-14(32-18-12-8-11-17(13-18)30-3)21(28)26-27-24(33)25-22-20(23(29)31-4)19(15(2)34-22)16-9-6-5-7-10-16/h5-14H,1-4H3,(H,26,28)(H2,25,27,33)/t14-/m1/s1 |
| InChIKey | LVVSYNOAGFDHQF-CQSZACIVSA-N |
| XLogP | 4.30 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|