C25H25N3O6S2 — CID 2956472
ethyl 2-[[2-(1,3-benzodioxol-5-yloxy)propanoylamino]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 2956472) has the molecular formula C25H25N3O6S2 and a molecular weight of 527.62 g/mol. Its IUPAC name is ethyl 2-[[2-(1,3-benzodioxol-5-yloxy)propanoylamino]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(1,3-benzodioxol-5-yloxy)propanoylamino]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2956472 |
| Molecular Formula | C25H25N3O6S2 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | ethyl 2-[[2-(1,3-benzodioxol-5-yloxy)propanoylamino]carbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NNC(=O)C(C)Oc2ccc3c(c2)OCO3)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C25H25N3O6S2/c1-4-31-24(30)21-20(16-8-6-5-7-9-16)15(3)36-23(21)26-25(35)28-27-22(29)14(2)34-17-10-11-18-19(12-17)33-13-32-18/h5-12,14H,4,13H2,1-3H3,(H,27,29)(H2,26,28,35) |
| InChIKey | JTZSEGZPYYCCFH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|