C20H14BrN3OS — CID 2883257
N-[1-(1H-benzimidazol-2-yl)-2-(4-bromophenyl)ethenyl]thiophene-2-carboxamide (PubChem CID 2883257) has the molecular formula C20H14BrN3OS and a molecular weight of 424.32 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-2-(4-bromophenyl)ethenyl]thiophene-2-carboxamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-2-(4-bromophenyl)ethenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2883257 |
| Molecular Formula | C20H14BrN3OS |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-2-(4-bromophenyl)ethenyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=Cc1ccc(Br)cc1)c1nc2ccccc2[nH]1)c1cccs1 |
| InChI | InChI=1S/C20H14BrN3OS/c21-14-9-7-13(8-10-14)12-17(24-20(25)18-6-3-11-26-18)19-22-15-4-1-2-5-16(15)23-19/h1-12H,(H,22,23)(H,24,25) |
| InChIKey | SHOYNIQDFXZNKN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |