C20H12Br2N2O2S — CID 5022344
2-(1H-benzimidazol-2-yl)-3-(3,5-dibromo-4-hydroxyphenyl)-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 5022344) has the molecular formula C20H12Br2N2O2S and a molecular weight of 504.20 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-(3,5-dibromo-4-hydroxyphenyl)-1-thiophen-2-ylprop-2-en-1-one.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-(3,5-dibromo-4-hydroxyphenyl)-1-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 5022344 |
| Molecular Formula | C20H12Br2N2O2S |
| Molecular Weight | 504.20 g/mol |
| Exact Mass | 501.90 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-(3,5-dibromo-4-hydroxyphenyl)-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(C(=Cc1cc(Br)c(O)c(Br)c1)c1nc2ccccc2[nH]1)c1cccs1 |
| InChI | InChI=1S/C20H12Br2N2O2S/c21-13-9-11(10-14(22)19(13)26)8-12(18(25)17-6-3-7-27-17)20-23-15-4-1-2-5-16(15)24-20/h1-10,26H,(H,23,24) |
| InChIKey | BBIAUVLGTPVPOC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.20 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|