C15H18N4O6S — CID 28843486
2-[[2-[[6-(2-methoxyethoxycarbonyl)-5-methylthieno[2,3-d]pyrimidin-4-yl]amino]acetyl]amino]acetic acid (PubChem CID 28843486) has the molecular formula C15H18N4O6S and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-[[2-[[6-(2-methoxyethoxycarbonyl)-5-methylthieno[2,3-d]pyrimidin-4-yl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[6-(2-methoxyethoxycarbonyl)-5-methylthieno[2,3-d]pyrimidin-4-yl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 28843486 |
| Molecular Formula | C15H18N4O6S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[[2-[[6-(2-methoxyethoxycarbonyl)-5-methylthieno[2,3-d]pyrimidin-4-yl]amino]acetyl]amino]acetic acid |
| SMILES | COCCOC(=O)c1sc2ncnc(NCC(=O)NCC(=O)O)c2c1C |
| InChI | InChI=1S/C15H18N4O6S/c1-8-11-13(17-5-9(20)16-6-10(21)22)18-7-19-14(11)26-12(8)15(23)25-4-3-24-2/h7H,3-6H2,1-2H3,(H,16,20)(H,21,22)(H,17,18,19) |
| InChIKey | XTVJTXFZHJQDEY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|