About 3-ethyl-1,1-diphenylurea
3-ethyl-1,1-diphenylurea (PubChem CID 28929) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-ethyl-1,1-diphenylurea.
Molecular Properties
| Compound Name | 3-ethyl-1,1-diphenylurea |
| PubChem CID | 28929 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-ethyl-1,1-diphenylurea |
| SMILES | CCNC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O/c1-2-16-15(18)17(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,16,18) |
| InChIKey | DIPWJRHVODJXKP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1,1-diphenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,1-diphenylurea?
The IUPAC name of 3-ethyl-1,1-diphenylurea (CID 28929) is 3-ethyl-1,1-diphenylurea.
What is the SMILES notation for 3-ethyl-1,1-diphenylurea?
The canonical SMILES for 3-ethyl-1,1-diphenylurea is CCNC(=O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-ethyl-1,1-diphenylurea?
The InChIKey is DIPWJRHVODJXKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O/c1-2-16-15(18)17(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,16,18).
What are the key properties of 3-ethyl-1,1-diphenylurea?
3-ethyl-1,1-diphenylurea has a molecular weight of 240.31 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,1-diphenylurea is sourced from PubChem (CID 28929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).