C22H22N2O5S2 — CID 2895770
5-[[2-[2-(2-butan-2-ylphenoxy)ethoxy]-5-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2895770) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 5-[[2-[2-(2-butan-2-ylphenoxy)ethoxy]-5-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-[2-(2-butan-2-ylphenoxy)ethoxy]-5-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2895770 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 5-[[2-[2-(2-butan-2-ylphenoxy)ethoxy]-5-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCC(C)c1ccccc1OCCOc1ccc([N+](=O)[O-])cc1C=C1SC(=S)NC1=O |
| InChI | InChI=1S/C22H22N2O5S2/c1-3-14(2)17-6-4-5-7-19(17)29-11-10-28-18-9-8-16(24(26)27)12-15(18)13-20-21(25)23-22(30)31-20/h4-9,12-14H,3,10-11H2,1-2H3,(H,23,25,30) |
| InChIKey | XFQPGQWDKQCJSU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|