C19H25N3O4 — CID 28960402
(1S,2S,3S,4R,5R)-4-(2-methoxyethylamino)-2-(quinolin-3-ylmethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 28960402) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-4-(2-methoxyethylamino)-2-(quinolin-3-ylmethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-4-(2-methoxyethylamino)-2-(quinolin-3-ylmethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 28960402 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (1S,2S,3S,4R,5R)-4-(2-methoxyethylamino)-2-(quinolin-3-ylmethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | COCCN[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](NCc2cnc3ccccc3c2)[C@@H]1O |
| InChI | InChI=1S/C19H25N3O4/c1-24-7-6-20-17-18(23)16(15-11-25-19(17)26-15)22-10-12-8-13-4-2-3-5-14(13)21-9-12/h2-5,8-9,15-20,22-23H,6-7,10-11H2,1H3/t15-,16-,17-,18+,19-/m1/s1 |
| InChIKey | NPPFGUCYRPVTDH-IEWDOMPSSA-N |
| XLogP | 0.41 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|