C27H42N2O5 — CID 28962452
(2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 28962452) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 28962452 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](C)[C@@H]2CC[C@@]3(C)CC[C@H](NC(C)=O)[C@@H](C)[C@@H]3[C@H]2O)cc1OC |
| InChI | InChI=1S/C27H42N2O5/c1-16(26(32)28-14-11-19-7-8-22(33-5)23(15-19)34-6)20-9-12-27(4)13-10-21(29-18(3)30)17(2)24(27)25(20)31/h7-8,15-17,20-21,24-25,31H,9-14H2,1-6H3,(H,28,32)(H,29,30)/t16-,17+,20-,21-,24+,25-,27-/m0/s1 |
| InChIKey | QMYFFOGQXBMUSD-NMIUIKKTSA-N |
| XLogP | 3.33 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |