C11H25NO — CID 29013902
(2R)-N-[(2S)-butan-2-yl]-4-methoxy-4-methylpentan-2-amine (PubChem CID 29013902) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is (2R)-N-[(2S)-butan-2-yl]-4-methoxy-4-methylpentan-2-amine.
| Compound Name | (2R)-N-[(2S)-butan-2-yl]-4-methoxy-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 29013902 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | (2R)-N-[(2S)-butan-2-yl]-4-methoxy-4-methylpentan-2-amine |
| SMILES | CC[C@H](C)N[C@H](C)CC(C)(C)OC |
| InChI | InChI=1S/C11H25NO/c1-7-9(2)12-10(3)8-11(4,5)13-6/h9-10,12H,7-8H2,1-6H3/t9-,10+/m0/s1 |
| InChIKey | QCLUFTPBEGLMEV-VHSXEESVSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |