C16H24N6O2 — CID 29026321
2-[1-[[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]methyl]triazol-4-yl]propan-2-ol (PubChem CID 29026321) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[1-[[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]methyl]triazol-4-yl]propan-2-ol.
| Compound Name | 2-[1-[[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]methyl]triazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 29026321 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[1-[[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]methyl]triazol-4-yl]propan-2-ol |
| SMILES | COc1ccnc(N2CCC(Cn3cc(C(C)(C)O)nn3)CC2)n1 |
| InChI | InChI=1S/C16H24N6O2/c1-16(2,23)13-11-22(20-19-13)10-12-5-8-21(9-6-12)15-17-7-4-14(18-15)24-3/h4,7,11-12,23H,5-6,8-10H2,1-3H3 |
| InChIKey | FVVLZSOVMJAODN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |