C15H22N6O2 — CID 29215484
3-[1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]triazol-4-yl]propan-1-ol (PubChem CID 29215484) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]triazol-4-yl]propan-1-ol.
| Compound Name | 3-[1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]triazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 29215484 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-[1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]triazol-4-yl]propan-1-ol |
| SMILES | COc1ccnc(N2CCC(n3cc(CCCO)nn3)CC2)n1 |
| InChI | InChI=1S/C15H22N6O2/c1-23-14-4-7-16-15(17-14)20-8-5-13(6-9-20)21-11-12(18-19-21)3-2-10-22/h4,7,11,13,22H,2-3,5-6,8-10H2,1H3 |
| InChIKey | ZPMXPDYLGYUXCF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |