C14H20N6O2 — CID 30868634
(1R)-1-[1-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]triazol-4-yl]ethanol (PubChem CID 30868634) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is (1R)-1-[1-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]triazol-4-yl]ethanol.
| Compound Name | (1R)-1-[1-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 30868634 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (1R)-1-[1-[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]triazol-4-yl]ethanol |
| SMILES | COc1cc(N2CCC(n3cc([C@@H](C)O)nn3)CC2)ncn1 |
| InChI | InChI=1S/C14H20N6O2/c1-10(21)12-8-20(18-17-12)11-3-5-19(6-4-11)13-7-14(22-2)16-9-15-13/h7-11,21H,3-6H2,1-2H3/t10-/m1/s1 |
| InChIKey | VDUJNCNTRKHLHP-SNVBAGLBSA-N |
| XLogP | 0.97 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |