C23H22Cl2N2S — CID 29039412
1-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 29039412) has the molecular formula C23H22Cl2N2S and a molecular weight of 429.42 g/mol. Its IUPAC name is 1-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 29039412 |
| Molecular Formula | C23H22Cl2N2S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | C[C@@H](NC(=S)N(Cc1ccccc1)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C23H22Cl2N2S/c1-17(20-10-6-3-7-11-20)26-23(28)27(15-18-8-4-2-5-9-18)16-19-12-13-21(24)22(25)14-19/h2-14,17H,15-16H2,1H3,(H,26,28)/t17-/m1/s1 |
| InChIKey | RNOQTNJERDENNQ-QGZVFWFLSA-N |
| XLogP | 6.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|