C26H26N2S — CID 53320206
1-benzyl-1-[[3-(2-phenylethynyl)phenyl]methyl]-3-propan-2-ylthiourea (PubChem CID 53320206) has the molecular formula C26H26N2S and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-benzyl-1-[[3-(2-phenylethynyl)phenyl]methyl]-3-propan-2-ylthiourea.
| Compound Name | 1-benzyl-1-[[3-(2-phenylethynyl)phenyl]methyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 53320206 |
| Molecular Formula | C26H26N2S |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-benzyl-1-[[3-(2-phenylethynyl)phenyl]methyl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N(Cc1ccccc1)Cc1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2S/c1-21(2)27-26(29)28(19-24-12-7-4-8-13-24)20-25-15-9-14-23(18-25)17-16-22-10-5-3-6-11-22/h3-15,18,21H,19-20H2,1-2H3,(H,27,29) |
| InChIKey | ZRRPWFGCNTYIRS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|