C8H6FN3S — CID 29064827
4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 29064827) has the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 29064827 |
| Molecular Formula | C8H6FN3S |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1ccc(-n2cn[nH]c2=S)cc1 |
| InChI | InChI=1S/C8H6FN3S/c9-6-1-3-7(4-2-6)12-5-10-11-8(12)13/h1-5H,(H,11,13) |
| InChIKey | HTVMWOBMXSEYDG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|