C8H5N5S — CID 135412971
2H-[1,2,4]triazolo[3,4-c][1,2,4]benzotriazine-1-thione (PubChem CID 135412971) has the molecular formula C8H5N5S and a molecular weight of 203.23 g/mol. Its IUPAC name is 2H-[1,2,4]triazolo[3,4-c][1,2,4]benzotriazine-1-thione.
| Compound Name | 2H-[1,2,4]triazolo[3,4-c][1,2,4]benzotriazine-1-thione |
|---|---|
| PubChem CID | 135412971 |
| Molecular Formula | C8H5N5S |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2H-[1,2,4]triazolo[3,4-c][1,2,4]benzotriazine-1-thione |
| SMILES | S=c1[nH]nc2nnc3ccccc3n12 |
| InChI | InChI=1S/C8H5N5S/c14-8-12-11-7-10-9-5-3-1-2-4-6(5)13(7)8/h1-4H,(H,12,14) |
| InChIKey | JWXIEVCLWJHLBS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_K(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|