C14H12N4S — CID 667525
3-anilino-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 667525) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is 3-anilino-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-anilino-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 667525 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-anilino-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(Nc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C14H12N4S/c19-14-17-16-13(15-11-7-3-1-4-8-11)18(14)12-9-5-2-6-10-12/h1-10H,(H,15,16)(H,17,19) |
| InChIKey | ADVANMXLTWBUFC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|