C12H18N2O5S — CID 29077373
5-[methyl-(1-methylpiperidin-1-ium-4-yl)sulfamoyl]furan-2-carboxylate (PubChem CID 29077373) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 5-[methyl-(1-methylpiperidin-1-ium-4-yl)sulfamoyl]furan-2-carboxylate.
| Compound Name | 5-[methyl-(1-methylpiperidin-1-ium-4-yl)sulfamoyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 29077373 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[methyl-(1-methylpiperidin-1-ium-4-yl)sulfamoyl]furan-2-carboxylate |
| SMILES | CN(C1CC[NH+](C)CC1)S(=O)(=O)c1ccc(C(=O)[O-])o1 |
| InChI | InChI=1S/C12H18N2O5S/c1-13-7-5-9(6-8-13)14(2)20(17,18)11-4-3-10(19-11)12(15)16/h3-4,9H,5-8H2,1-2H3,(H,15,16) |
| InChIKey | YRYYPRMGEHLLOL-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |