C16H27N4O3S+ — CID 9453496
1-ethyl-3-[4-[methyl-(1-methylpiperidin-1-ium-4-yl)sulfamoyl]phenyl]urea (PubChem CID 9453496) has the molecular formula C16H27N4O3S+ and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-ethyl-3-[4-[methyl-(1-methylpiperidin-1-ium-4-yl)sulfamoyl]phenyl]urea.
| Compound Name | 1-ethyl-3-[4-[methyl-(1-methylpiperidin-1-ium-4-yl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 9453496 |
| Molecular Formula | C16H27N4O3S+ |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 1-ethyl-3-[4-[methyl-(1-methylpiperidin-1-ium-4-yl)sulfamoyl]phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(S(=O)(=O)N(C)C2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C16H26N4O3S/c1-4-17-16(21)18-13-5-7-15(8-6-13)24(22,23)20(3)14-9-11-19(2)12-10-14/h5-8,14H,4,9-12H2,1-3H3,(H2,17,18,21)/p+1 |
| InChIKey | PAEIFAUSGUEPFA-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |