About (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid
(5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 29078862) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
Analyze (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The IUPAC name of (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CID 29078862) is (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid is O=C(O)[C@H]1CC(c2ccccn2)=NO1.
What is the InChIKey of (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
The InChIKey is RKEQTVJMWSCNBP-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H8N2O3/c12-9(13)8-5-7(11-14-8)6-3-1-2-4-10-6/h1-4,8H,5H2,(H,12,13)/t8-/m1/s1.
What are the key properties of (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid?
(5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid has a molecular weight of 192.17 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 29078862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).