C16H22N3OP — CID 143032047
N-[(Z)-but-1-enyl]-1-(3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)prop-2-en-1-imine;methylphosphane (PubChem CID 143032047) has the molecular formula C16H22N3OP and a molecular weight of 303.35 g/mol. Its IUPAC name is N-[(Z)-but-1-enyl]-1-(3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)prop-2-en-1-imine;methylphosphane.
| Compound Name | N-[(Z)-but-1-enyl]-1-(3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)prop-2-en-1-imine;methylphosphane |
|---|---|
| PubChem CID | 143032047 |
| Molecular Formula | C16H22N3OP |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[(Z)-but-1-enyl]-1-(3-pyridin-2-yl-4,5-dihydro-1,2-oxazol-5-yl)prop-2-en-1-imine;methylphosphane |
| SMILES | C=C/C(=N\C=C/CC)C1CC(c2ccccn2)=NO1.CP |
| InChI | InChI=1S/C15H17N3O.CH5P/c1-3-5-9-16-12(4-2)15-11-14(18-19-15)13-8-6-7-10-17-13;1-2/h4-10,15H,2-3,11H2,1H3;2H2,1H3/b9-5-,16-12+; |
| InChIKey | SBGTUSPTYXGSBX-OUDJNKSRSA-N |
| XLogP | 3.62 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|