C9H10N2O3S — CID 71713998
5-methylsulfonyl-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole (PubChem CID 71713998) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 5-methylsulfonyl-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-methylsulfonyl-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 71713998 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 5-methylsulfonyl-3-pyridin-2-yl-4,5-dihydro-1,2-oxazole |
| SMILES | CS(=O)(=O)C1CC(c2ccccn2)=NO1 |
| InChI | InChI=1S/C9H10N2O3S/c1-15(12,13)9-6-8(11-14-9)7-4-2-3-5-10-7/h2-5,9H,6H2,1H3 |
| InChIKey | JCXXTSCKUDXUFX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |