C22H27F3N4O4 — CID 29104833
2-[4-[(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)methyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 29104833) has the molecular formula C22H27F3N4O4 and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-[4-[(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)methyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-[(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)methyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 29104833 |
| Molecular Formula | C22H27F3N4O4 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 2-[4-[(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)methyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1CCN(CN2C(=O)CC3(CCCC3)C2=O)CC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F3N4O4/c23-22(24,25)33-17-5-3-16(4-6-17)26-18(30)14-27-9-11-28(12-10-27)15-29-19(31)13-21(20(29)32)7-1-2-8-21/h3-6H,1-2,7-15H2,(H,26,30) |
| InChIKey | YWVFNGGKCXKKHF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|