C21H21ClFN3O2S — CID 29115495
3-chloro-2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4-methylquinoline (PubChem CID 29115495) has the molecular formula C21H21ClFN3O2S and a molecular weight of 433.94 g/mol. Its IUPAC name is 3-chloro-2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4-methylquinoline.
| Compound Name | 3-chloro-2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4-methylquinoline |
|---|---|
| PubChem CID | 29115495 |
| Molecular Formula | C21H21ClFN3O2S |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-chloro-2-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-4-methylquinoline |
| SMILES | Cc1c(Cl)c(CN2CCN(S(=O)(=O)c3ccccc3F)CC2)nc2ccccc12 |
| InChI | InChI=1S/C21H21ClFN3O2S/c1-15-16-6-2-4-8-18(16)24-19(21(15)22)14-25-10-12-26(13-11-25)29(27,28)20-9-5-3-7-17(20)23/h2-9H,10-14H2,1H3 |
| InChIKey | KYORHDLDARKGMC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |