C15H16N6O — CID 29133372
N'-(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)-3-phenylpropanehydrazide (PubChem CID 29133372) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is N'-(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)-3-phenylpropanehydrazide.
| Compound Name | N'-(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)-3-phenylpropanehydrazide |
|---|---|
| PubChem CID | 29133372 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N'-(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)-3-phenylpropanehydrazide |
| SMILES | Cn1ncc2c(NNC(=O)CCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C15H16N6O/c1-21-15-12(9-18-21)14(16-10-17-15)20-19-13(22)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,19,22)(H,16,17,20) |
| InChIKey | WDKJAYXMMXHDCB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|