C19H26N4O4S — CID 29136158
N-[2-(1H-indol-3-yl)ethyl]-4-(4-methylsulfonylpiperazin-1-yl)-4-oxobutanamide (PubChem CID 29136158) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-4-(4-methylsulfonylpiperazin-1-yl)-4-oxobutanamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-4-(4-methylsulfonylpiperazin-1-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 29136158 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-4-(4-methylsulfonylpiperazin-1-yl)-4-oxobutanamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CCC(=O)NCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H26N4O4S/c1-28(26,27)23-12-10-22(11-13-23)19(25)7-6-18(24)20-9-8-15-14-21-17-5-3-2-4-16(15)17/h2-5,14,21H,6-13H2,1H3,(H,20,24) |
| InChIKey | CJBYJXLXGBDHMO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |