C22H29N3O4S2 — CID 2914583
4-methyl-N-[1-[3-(4-methylphenyl)sulfonyl-2-propan-2-ylimidazolidin-1-yl]ethylidene]benzenesulfonamide (PubChem CID 2914583) has the molecular formula C22H29N3O4S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 4-methyl-N-[1-[3-(4-methylphenyl)sulfonyl-2-propan-2-ylimidazolidin-1-yl]ethylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-[3-(4-methylphenyl)sulfonyl-2-propan-2-ylimidazolidin-1-yl]ethylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 2914583 |
| Molecular Formula | C22H29N3O4S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-methyl-N-[1-[3-(4-methylphenyl)sulfonyl-2-propan-2-ylimidazolidin-1-yl]ethylidene]benzenesulfonamide |
| SMILES | CC(=NS(=O)(=O)c1ccc(C)cc1)N1CCN(S(=O)(=O)c2ccc(C)cc2)C1C(C)C |
| InChI | InChI=1S/C22H29N3O4S2/c1-16(2)22-24(19(5)23-30(26,27)20-10-6-17(3)7-11-20)14-15-25(22)31(28,29)21-12-8-18(4)9-13-21/h6-13,16,22H,14-15H2,1-5H3 |
| InChIKey | SEXSBGFPNSOKKX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|