C29H34N4O4S2 — CID 98138047
4-methyl-N-[1-[(2S)-3-(4-methylphenyl)sulfonyl-2-phenylimidazolidin-1-yl]-2-pyrrolidin-1-ylethylidene]benzenesulfonamide (PubChem CID 98138047) has the molecular formula C29H34N4O4S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 4-methyl-N-[1-[(2S)-3-(4-methylphenyl)sulfonyl-2-phenylimidazolidin-1-yl]-2-pyrrolidin-1-ylethylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-[(2S)-3-(4-methylphenyl)sulfonyl-2-phenylimidazolidin-1-yl]-2-pyrrolidin-1-ylethylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 98138047 |
| Molecular Formula | C29H34N4O4S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 4-methyl-N-[1-[(2S)-3-(4-methylphenyl)sulfonyl-2-phenylimidazolidin-1-yl]-2-pyrrolidin-1-ylethylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(CN2CCCC2)N2CCN(S(=O)(=O)c3ccc(C)cc3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N4O4S2/c1-23-10-14-26(15-11-23)38(34,35)30-28(22-31-18-6-7-19-31)32-20-21-33(29(32)25-8-4-3-5-9-25)39(36,37)27-16-12-24(2)13-17-27/h3-5,8-17,29H,6-7,18-22H2,1-2H3/t29-/m0/s1 |
| InChIKey | WECLQLQFDPKSDP-LJAQVGFWSA-N |
| XLogP | 4.19 |
| TPSA | 90.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|