C25H25ClN4O6S2 — CID 98240906
N-[2-chloro-1-[(2R)-3-(4-methylphenyl)sulfonyl-2-(3-nitrophenyl)imidazolidin-1-yl]ethylidene]-4-methylbenzenesulfonamide (PubChem CID 98240906) has the molecular formula C25H25ClN4O6S2 and a molecular weight of 577.08 g/mol. Its IUPAC name is N-[2-chloro-1-[(2R)-3-(4-methylphenyl)sulfonyl-2-(3-nitrophenyl)imidazolidin-1-yl]ethylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-chloro-1-[(2R)-3-(4-methylphenyl)sulfonyl-2-(3-nitrophenyl)imidazolidin-1-yl]ethylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 98240906 |
| Molecular Formula | C25H25ClN4O6S2 |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | N-[2-chloro-1-[(2R)-3-(4-methylphenyl)sulfonyl-2-(3-nitrophenyl)imidazolidin-1-yl]ethylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(CCl)N2CCN(S(=O)(=O)c3ccc(C)cc3)[C@@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H25ClN4O6S2/c1-18-6-10-22(11-7-18)37(33,34)27-24(17-26)28-14-15-29(38(35,36)23-12-8-19(2)9-13-23)25(28)20-4-3-5-21(16-20)30(31)32/h3-13,16,25H,14-15,17H2,1-2H3/t25-/m1/s1 |
| InChIKey | DKSQLNSYJLSCJD-RUZDIDTESA-N |
| XLogP | 4.24 |
| TPSA | 130.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|