C28H32N4O5S2 — CID 4656786
N-[1-[3-(benzenesulfonyl)-2-phenylimidazolidin-1-yl]-2-morpholin-4-ylethylidene]-4-methylbenzenesulfonamide (PubChem CID 4656786) has the molecular formula C28H32N4O5S2 and a molecular weight of 568.72 g/mol. Its IUPAC name is N-[1-[3-(benzenesulfonyl)-2-phenylimidazolidin-1-yl]-2-morpholin-4-ylethylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-[3-(benzenesulfonyl)-2-phenylimidazolidin-1-yl]-2-morpholin-4-ylethylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4656786 |
| Molecular Formula | C28H32N4O5S2 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | N-[1-[3-(benzenesulfonyl)-2-phenylimidazolidin-1-yl]-2-morpholin-4-ylethylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(CN2CCOCC2)N2CCN(S(=O)(=O)c3ccccc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32N4O5S2/c1-23-12-14-25(15-13-23)38(33,34)29-27(22-30-18-20-37-21-19-30)31-16-17-32(28(31)24-8-4-2-5-9-24)39(35,36)26-10-6-3-7-11-26/h2-15,28H,16-22H2,1H3 |
| InChIKey | GWQGVWBAXNVPMF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|