C25H34N4O4S2 — CID 92849277
4-methyl-N-[1-[(2R)-2-methyl-3-(4-methylphenyl)sulfonylimidazolidin-1-yl]-2-piperidin-1-ylethylidene]benzenesulfonamide (PubChem CID 92849277) has the molecular formula C25H34N4O4S2 and a molecular weight of 518.71 g/mol. Its IUPAC name is 4-methyl-N-[1-[(2R)-2-methyl-3-(4-methylphenyl)sulfonylimidazolidin-1-yl]-2-piperidin-1-ylethylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-[(2R)-2-methyl-3-(4-methylphenyl)sulfonylimidazolidin-1-yl]-2-piperidin-1-ylethylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 92849277 |
| Molecular Formula | C25H34N4O4S2 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-methyl-N-[1-[(2R)-2-methyl-3-(4-methylphenyl)sulfonylimidazolidin-1-yl]-2-piperidin-1-ylethylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(CN2CCCCC2)N2CCN(S(=O)(=O)c3ccc(C)cc3)[C@@H]2C)cc1 |
| InChI | InChI=1S/C25H34N4O4S2/c1-20-7-11-23(12-8-20)34(30,31)26-25(19-27-15-5-4-6-16-27)28-17-18-29(22(28)3)35(32,33)24-13-9-21(2)10-14-24/h7-14,22H,4-6,15-19H2,1-3H3/t22-/m1/s1 |
| InChIKey | BXAGKSMZRTUNAY-JOCHJYFZSA-N |
| XLogP | 3.23 |
| TPSA | 90.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|