C29H36N4O4S2 — CID 71831054
N-[2-(benzylamino)-1-[3-(4-methylphenyl)sulfonyl-2-propan-2-ylimidazolidin-1-yl]ethylidene]-4-methylbenzenesulfonamide (PubChem CID 71831054) has the molecular formula C29H36N4O4S2 and a molecular weight of 568.77 g/mol. Its IUPAC name is N-[2-(benzylamino)-1-[3-(4-methylphenyl)sulfonyl-2-propan-2-ylimidazolidin-1-yl]ethylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(benzylamino)-1-[3-(4-methylphenyl)sulfonyl-2-propan-2-ylimidazolidin-1-yl]ethylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71831054 |
| Molecular Formula | C29H36N4O4S2 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | N-[2-(benzylamino)-1-[3-(4-methylphenyl)sulfonyl-2-propan-2-ylimidazolidin-1-yl]ethylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(CNCc2ccccc2)N2CCN(S(=O)(=O)c3ccc(C)cc3)C2C(C)C)cc1 |
| InChI | InChI=1S/C29H36N4O4S2/c1-22(2)29-32(18-19-33(29)39(36,37)27-16-12-24(4)13-17-27)28(21-30-20-25-8-6-5-7-9-25)31-38(34,35)26-14-10-23(3)11-15-26/h5-17,22,29-30H,18-21H2,1-4H3 |
| InChIKey | FPBMOKLQJNSIJW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|