C19H16N4O6 — CID 29170468
[2-(2-nitroanilino)-2-oxoethyl] 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate (PubChem CID 29170468) has the molecular formula C19H16N4O6 and a molecular weight of 396.36 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 29170468 |
| Molecular Formula | C19H16N4O6 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate |
| SMILES | O=C(COC(=O)C1=NN(c2ccccc2)C(=O)CC1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O6/c24-17(20-14-8-4-5-9-16(14)23(27)28)12-29-19(26)15-10-11-18(25)22(21-15)13-6-2-1-3-7-13/h1-9H,10-12H2,(H,20,24) |
| InChIKey | OISSAGIESLMURK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|