C20H23N5O3 — CID 29185311
6-[(4-methoxyphenyl)methyl-methylamino]-1-(3-methylbut-2-enyl)-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione (PubChem CID 29185311) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methyl-methylamino]-1-(3-methylbut-2-enyl)-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione.
| Compound Name | 6-[(4-methoxyphenyl)methyl-methylamino]-1-(3-methylbut-2-enyl)-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione |
|---|---|
| PubChem CID | 29185311 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 6-[(4-methoxyphenyl)methyl-methylamino]-1-(3-methylbut-2-enyl)-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione |
| SMILES | COc1ccc(CN(C)c2nc(=O)c3ncn(CC=C(C)C)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-13(2)9-10-25-12-21-16-17(25)19(27)23-20(22-18(16)26)24(3)11-14-5-7-15(28-4)8-6-14/h5-9,12H,10-11H2,1-4H3,(H,22,23,26,27) |
| InChIKey | XGHVULFIAIAVFY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|