C17H15BrFN3O2 — CID 155463928
5-bromo-8-fluoro-2-[(4-methoxyphenyl)methyl-methylamino]-3H-quinazolin-4-one (PubChem CID 155463928) has the molecular formula C17H15BrFN3O2 and a molecular weight of 392.23 g/mol. Its IUPAC name is 5-bromo-8-fluoro-2-[(4-methoxyphenyl)methyl-methylamino]-3H-quinazolin-4-one.
| Compound Name | 5-bromo-8-fluoro-2-[(4-methoxyphenyl)methyl-methylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 155463928 |
| Molecular Formula | C17H15BrFN3O2 |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 5-bromo-8-fluoro-2-[(4-methoxyphenyl)methyl-methylamino]-3H-quinazolin-4-one |
| SMILES | COc1ccc(CN(C)c2nc3c(F)ccc(Br)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H15BrFN3O2/c1-22(9-10-3-5-11(24-2)6-4-10)17-20-15-13(19)8-7-12(18)14(15)16(23)21-17/h3-8H,9H2,1-2H3,(H,20,21,23) |
| InChIKey | OQEKIEUPKQBLJD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |